C14H15NO4S2 — CID 39792029
(4-methylphenyl) 5-(acetamidomethyl)thiophene-2-sulfonate (PubChem CID 39792029) has the molecular formula C14H15NO4S2 and a molecular weight of 325.41 g/mol. Its IUPAC name is (4-methylphenyl) 5-(acetamidomethyl)thiophene-2-sulfonate.
| Compound Name | (4-methylphenyl) 5-(acetamidomethyl)thiophene-2-sulfonate |
|---|---|
| PubChem CID | 39792029 |
| Molecular Formula | C14H15NO4S2 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.04 |
| IUPAC Name | (4-methylphenyl) 5-(acetamidomethyl)thiophene-2-sulfonate |
| SMILES | CC(=O)NCc1ccc(S(=O)(=O)Oc2ccc(C)cc2)s1 |
| InChI | InChI=1S/C14H15NO4S2/c1-10-3-5-12(6-4-10)19-21(17,18)14-8-7-13(20-14)9-15-11(2)16/h3-8H,9H2,1-2H3,(H,15,16) |
| InChIKey | NBDLXDSDFQNMHW-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|