C16H18ClNO4S2 — CID 60561272
(4-chloro-3-ethylphenyl) 5-(2-acetamidoethyl)thiophene-2-sulfonate (PubChem CID 60561272) has the molecular formula C16H18ClNO4S2 and a molecular weight of 387.91 g/mol. Its IUPAC name is (4-chloro-3-ethylphenyl) 5-(2-acetamidoethyl)thiophene-2-sulfonate.
| Compound Name | (4-chloro-3-ethylphenyl) 5-(2-acetamidoethyl)thiophene-2-sulfonate |
|---|---|
| PubChem CID | 60561272 |
| Molecular Formula | C16H18ClNO4S2 |
| Molecular Weight | 387.91 g/mol |
| Exact Mass | 387.04 |
| IUPAC Name | (4-chloro-3-ethylphenyl) 5-(2-acetamidoethyl)thiophene-2-sulfonate |
| SMILES | CCc1cc(OS(=O)(=O)c2ccc(CCNC(C)=O)s2)ccc1Cl |
| InChI | InChI=1S/C16H18ClNO4S2/c1-3-12-10-13(4-6-15(12)17)22-24(20,21)16-7-5-14(23-16)8-9-18-11(2)19/h4-7,10H,3,8-9H2,1-2H3,(H,18,19) |
| InChIKey | MSQLCPXILUTNHL-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.91 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|