C13H24ClN3O4S2 — CID 120717360
N-[2-[5-[2-(2-methoxyethylamino)ethylsulfamoyl]thiophen-2-yl]ethyl]acetamide;hydrochloride (PubChem CID 120717360) has the molecular formula C13H24ClN3O4S2 and a molecular weight of 385.94 g/mol. Its IUPAC name is N-[2-[5-[2-(2-methoxyethylamino)ethylsulfamoyl]thiophen-2-yl]ethyl]acetamide;hydrochloride.
| Compound Name | N-[2-[5-[2-(2-methoxyethylamino)ethylsulfamoyl]thiophen-2-yl]ethyl]acetamide;hydrochloride |
|---|---|
| PubChem CID | 120717360 |
| Molecular Formula | C13H24ClN3O4S2 |
| Molecular Weight | 385.94 g/mol |
| Exact Mass | 385.09 |
| IUPAC Name | N-[2-[5-[2-(2-methoxyethylamino)ethylsulfamoyl]thiophen-2-yl]ethyl]acetamide;hydrochloride |
| SMILES | COCCNCCNS(=O)(=O)c1ccc(CCNC(C)=O)s1.Cl |
| InChI | InChI=1S/C13H23N3O4S2.ClH/c1-11(17)15-6-5-12-3-4-13(21-12)22(18,19)16-8-7-14-9-10-20-2;/h3-4,14,16H,5-10H2,1-2H3,(H,15,17);1H |
| InChIKey | GWZYIXSKAIASQE-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.94 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|