C15H28Cl2N4O3S2 — CID 119994670
N-[2-[5-(3-piperazin-1-ylpropylsulfamoyl)thiophen-2-yl]ethyl]acetamide;dihydrochloride (PubChem CID 119994670) has the molecular formula C15H28Cl2N4O3S2 and a molecular weight of 447.45 g/mol. Its IUPAC name is N-[2-[5-(3-piperazin-1-ylpropylsulfamoyl)thiophen-2-yl]ethyl]acetamide;dihydrochloride.
| Compound Name | N-[2-[5-(3-piperazin-1-ylpropylsulfamoyl)thiophen-2-yl]ethyl]acetamide;dihydrochloride |
|---|---|
| PubChem CID | 119994670 |
| Molecular Formula | C15H28Cl2N4O3S2 |
| Molecular Weight | 447.45 g/mol |
| Exact Mass | 446.10 |
| IUPAC Name | N-[2-[5-(3-piperazin-1-ylpropylsulfamoyl)thiophen-2-yl]ethyl]acetamide;dihydrochloride |
| SMILES | CC(=O)NCCc1ccc(S(=O)(=O)NCCCN2CCNCC2)s1.Cl.Cl |
| InChI | InChI=1S/C15H26N4O3S2.2ClH/c1-13(20)17-7-5-14-3-4-15(23-14)24(21,22)18-6-2-10-19-11-8-16-9-12-19;;/h3-4,16,18H,2,5-12H2,1H3,(H,17,20);2*1H |
| InChIKey | GHBHDYQBLSYYOF-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.45 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|