C15H27N3O3S2 — CID 120583485
N-[2-[5-(4-aminobutylsulfamoyl)thiophen-2-yl]ethyl]-2,2-dimethylpropanamide (PubChem CID 120583485) has the molecular formula C15H27N3O3S2 and a molecular weight of 361.53 g/mol. Its IUPAC name is N-[2-[5-(4-aminobutylsulfamoyl)thiophen-2-yl]ethyl]-2,2-dimethylpropanamide.
| Compound Name | N-[2-[5-(4-aminobutylsulfamoyl)thiophen-2-yl]ethyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 120583485 |
| Molecular Formula | C15H27N3O3S2 |
| Molecular Weight | 361.53 g/mol |
| Exact Mass | 361.15 |
| IUPAC Name | N-[2-[5-(4-aminobutylsulfamoyl)thiophen-2-yl]ethyl]-2,2-dimethylpropanamide |
| SMILES | CC(C)(C)C(=O)NCCc1ccc(S(=O)(=O)NCCCCN)s1 |
| InChI | InChI=1S/C15H27N3O3S2/c1-15(2,3)14(19)17-11-8-12-6-7-13(22-12)23(20,21)18-10-5-4-9-16/h6-7,18H,4-5,8-11,16H2,1-3H3,(H,17,19) |
| InChIKey | NSQPNPJMPPOAQW-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.53 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|