C13H23N3O4S2 — CID 120717361
N-[2-[5-[2-(2-methoxyethylamino)ethylsulfamoyl]thiophen-2-yl]ethyl]acetamide (PubChem CID 120717361) has the molecular formula C13H23N3O4S2 and a molecular weight of 349.48 g/mol. Its IUPAC name is N-[2-[5-[2-(2-methoxyethylamino)ethylsulfamoyl]thiophen-2-yl]ethyl]acetamide.
| Compound Name | N-[2-[5-[2-(2-methoxyethylamino)ethylsulfamoyl]thiophen-2-yl]ethyl]acetamide |
|---|---|
| PubChem CID | 120717361 |
| Molecular Formula | C13H23N3O4S2 |
| Molecular Weight | 349.48 g/mol |
| Exact Mass | 349.11 |
| IUPAC Name | N-[2-[5-[2-(2-methoxyethylamino)ethylsulfamoyl]thiophen-2-yl]ethyl]acetamide |
| SMILES | COCCNCCNS(=O)(=O)c1ccc(CCNC(C)=O)s1 |
| InChI | InChI=1S/C13H23N3O4S2/c1-11(17)15-6-5-12-3-4-13(21-12)22(18,19)16-8-7-14-9-10-20-2/h3-4,14,16H,5-10H2,1-2H3,(H,15,17) |
| InChIKey | QMMJRRKMXKVBPZ-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.48 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|