C10H16N2O4S2 — CID 30180963
N-[[5-(2-methoxyethylsulfamoyl)thiophen-2-yl]methyl]acetamide (PubChem CID 30180963) has the molecular formula C10H16N2O4S2 and a molecular weight of 292.38 g/mol. Its IUPAC name is N-[[5-(2-methoxyethylsulfamoyl)thiophen-2-yl]methyl]acetamide.
| Compound Name | N-[[5-(2-methoxyethylsulfamoyl)thiophen-2-yl]methyl]acetamide |
|---|---|
| PubChem CID | 30180963 |
| Molecular Formula | C10H16N2O4S2 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.06 |
| IUPAC Name | N-[[5-(2-methoxyethylsulfamoyl)thiophen-2-yl]methyl]acetamide |
| SMILES | COCCNS(=O)(=O)c1ccc(CNC(C)=O)s1 |
| InChI | InChI=1S/C10H16N2O4S2/c1-8(13)11-7-9-3-4-10(17-9)18(14,15)12-5-6-16-2/h3-4,12H,5-7H2,1-2H3,(H,11,13) |
| InChIKey | NOJOVLMERSZDJD-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|