C13H22N2O5S2 — CID 55364957
N-[[5-[bis(2-methoxyethyl)sulfamoyl]thiophen-2-yl]methyl]acetamide (PubChem CID 55364957) has the molecular formula C13H22N2O5S2 and a molecular weight of 350.46 g/mol. Its IUPAC name is N-[[5-[bis(2-methoxyethyl)sulfamoyl]thiophen-2-yl]methyl]acetamide.
| Compound Name | N-[[5-[bis(2-methoxyethyl)sulfamoyl]thiophen-2-yl]methyl]acetamide |
|---|---|
| PubChem CID | 55364957 |
| Molecular Formula | C13H22N2O5S2 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.10 |
| IUPAC Name | N-[[5-[bis(2-methoxyethyl)sulfamoyl]thiophen-2-yl]methyl]acetamide |
| SMILES | COCCN(CCOC)S(=O)(=O)c1ccc(CNC(C)=O)s1 |
| InChI | InChI=1S/C13H22N2O5S2/c1-11(16)14-10-12-4-5-13(21-12)22(17,18)15(6-8-19-2)7-9-20-3/h4-5H,6-10H2,1-3H3,(H,14,16) |
| InChIKey | XUOZNTLTSBIHBI-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |