C14H24N2O3S2 — CID 103340653
N-(2-methoxyethyl)-N-prop-2-enyl-5-(propylaminomethyl)thiophene-2-sulfonamide (PubChem CID 103340653) has the molecular formula C14H24N2O3S2 and a molecular weight of 332.49 g/mol. Its IUPAC name is N-(2-methoxyethyl)-N-prop-2-enyl-5-(propylaminomethyl)thiophene-2-sulfonamide.
| Compound Name | N-(2-methoxyethyl)-N-prop-2-enyl-5-(propylaminomethyl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 103340653 |
| Molecular Formula | C14H24N2O3S2 |
| Molecular Weight | 332.49 g/mol |
| Exact Mass | 332.12 |
| IUPAC Name | N-(2-methoxyethyl)-N-prop-2-enyl-5-(propylaminomethyl)thiophene-2-sulfonamide |
| SMILES | C=CCN(CCOC)S(=O)(=O)c1ccc(CNCCC)s1 |
| InChI | InChI=1S/C14H24N2O3S2/c1-4-8-15-12-13-6-7-14(20-13)21(17,18)16(9-5-2)10-11-19-3/h5-7,15H,2,4,8-12H2,1,3H3 |
| InChIKey | CGEZABCIJXVDMH-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.49 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|