C12H22N4O3S — CID 103340623
4-(ethylaminomethyl)-N-(2-methoxyethyl)-N-prop-2-enyl-1H-pyrazole-5-sulfonamide (PubChem CID 103340623) has the molecular formula C12H22N4O3S and a molecular weight of 302.40 g/mol. Its IUPAC name is 4-(ethylaminomethyl)-N-(2-methoxyethyl)-N-prop-2-enyl-1H-pyrazole-5-sulfonamide.
| Compound Name | 4-(ethylaminomethyl)-N-(2-methoxyethyl)-N-prop-2-enyl-1H-pyrazole-5-sulfonamide |
|---|---|
| PubChem CID | 103340623 |
| Molecular Formula | C12H22N4O3S |
| Molecular Weight | 302.40 g/mol |
| Exact Mass | 302.14 |
| IUPAC Name | 4-(ethylaminomethyl)-N-(2-methoxyethyl)-N-prop-2-enyl-1H-pyrazole-5-sulfonamide |
| SMILES | C=CCN(CCOC)S(=O)(=O)c1[nH]ncc1CNCC |
| InChI | InChI=1S/C12H22N4O3S/c1-4-6-16(7-8-19-3)20(17,18)12-11(9-13-5-2)10-14-15-12/h4,10,13H,1,5-9H2,2-3H3,(H,14,15) |
| InChIKey | PPBRQOCSEFAARQ-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 87.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.40 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|