C12H24N4O3S — CID 106085428
4-(ethylaminomethyl)-N-[2-(2-methylpropoxy)ethyl]-1H-pyrazole-5-sulfonamide (PubChem CID 106085428) has the molecular formula C12H24N4O3S and a molecular weight of 304.42 g/mol. Its IUPAC name is 4-(ethylaminomethyl)-N-[2-(2-methylpropoxy)ethyl]-1H-pyrazole-5-sulfonamide.
| Compound Name | 4-(ethylaminomethyl)-N-[2-(2-methylpropoxy)ethyl]-1H-pyrazole-5-sulfonamide |
|---|---|
| PubChem CID | 106085428 |
| Molecular Formula | C12H24N4O3S |
| Molecular Weight | 304.42 g/mol |
| Exact Mass | 304.16 |
| IUPAC Name | 4-(ethylaminomethyl)-N-[2-(2-methylpropoxy)ethyl]-1H-pyrazole-5-sulfonamide |
| SMILES | CCNCc1cn[nH]c1S(=O)(=O)NCCOCC(C)C |
| InChI | InChI=1S/C12H24N4O3S/c1-4-13-7-11-8-14-16-12(11)20(17,18)15-5-6-19-9-10(2)3/h8,10,13,15H,4-7,9H2,1-3H3,(H,14,16) |
| InChIKey | PCEBGZUMBHTRCY-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 96.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.42 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|