C11H19F3N4O2S — CID 115522891
4-(ethylaminomethyl)-N-(5,5,5-trifluoropentyl)-1H-pyrazole-5-sulfonamide (PubChem CID 115522891) has the molecular formula C11H19F3N4O2S and a molecular weight of 328.36 g/mol. Its IUPAC name is 4-(ethylaminomethyl)-N-(5,5,5-trifluoropentyl)-1H-pyrazole-5-sulfonamide.
| Compound Name | 4-(ethylaminomethyl)-N-(5,5,5-trifluoropentyl)-1H-pyrazole-5-sulfonamide |
|---|---|
| PubChem CID | 115522891 |
| Molecular Formula | C11H19F3N4O2S |
| Molecular Weight | 328.36 g/mol |
| Exact Mass | 328.12 |
| IUPAC Name | 4-(ethylaminomethyl)-N-(5,5,5-trifluoropentyl)-1H-pyrazole-5-sulfonamide |
| SMILES | CCNCc1cn[nH]c1S(=O)(=O)NCCCCC(F)(F)F |
| InChI | InChI=1S/C11H19F3N4O2S/c1-2-15-7-9-8-16-18-10(9)21(19,20)17-6-4-3-5-11(12,13)14/h8,15,17H,2-7H2,1H3,(H,16,18) |
| InChIKey | NAVMGEGPRZQDMU-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.36 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|