C10H16F3N3 — CID 115491490
5,5,5-trifluoro-N-[(5-methyl-1H-pyrazol-4-yl)methyl]pentan-1-amine (PubChem CID 115491490) has the molecular formula C10H16F3N3 and a molecular weight of 235.25 g/mol. Its IUPAC name is 5,5,5-trifluoro-N-[(5-methyl-1H-pyrazol-4-yl)methyl]pentan-1-amine.
| Compound Name | 5,5,5-trifluoro-N-[(5-methyl-1H-pyrazol-4-yl)methyl]pentan-1-amine |
|---|---|
| PubChem CID | 115491490 |
| Molecular Formula | C10H16F3N3 |
| Molecular Weight | 235.25 g/mol |
| Exact Mass | 235.13 |
| IUPAC Name | 5,5,5-trifluoro-N-[(5-methyl-1H-pyrazol-4-yl)methyl]pentan-1-amine |
| SMILES | Cc1[nH]ncc1CNCCCCC(F)(F)F |
| InChI | InChI=1S/C10H16F3N3/c1-8-9(7-15-16-8)6-14-5-3-2-4-10(11,12)13/h7,14H,2-6H2,1H3,(H,15,16) |
| InChIKey | NOKMLRLXCQPCMR-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.25 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|