C9H17FN4O2S — CID 114267237
N-(2-fluoroethyl)-4-(propylaminomethyl)-1H-pyrazole-5-sulfonamide (PubChem CID 114267237) has the molecular formula C9H17FN4O2S and a molecular weight of 264.33 g/mol. Its IUPAC name is N-(2-fluoroethyl)-4-(propylaminomethyl)-1H-pyrazole-5-sulfonamide.
| Compound Name | N-(2-fluoroethyl)-4-(propylaminomethyl)-1H-pyrazole-5-sulfonamide |
|---|---|
| PubChem CID | 114267237 |
| Molecular Formula | C9H17FN4O2S |
| Molecular Weight | 264.33 g/mol |
| Exact Mass | 264.11 |
| IUPAC Name | N-(2-fluoroethyl)-4-(propylaminomethyl)-1H-pyrazole-5-sulfonamide |
| SMILES | CCCNCc1cn[nH]c1S(=O)(=O)NCCF |
| InChI | InChI=1S/C9H17FN4O2S/c1-2-4-11-6-8-7-12-14-9(8)17(15,16)13-5-3-10/h7,11,13H,2-6H2,1H3,(H,12,14) |
| InChIKey | YEGPSJYCKKFZTQ-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.33 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|