C12H24N6O2S — CID 106075528
N-(4-methylpiperazin-1-yl)-4-(propylaminomethyl)-1H-pyrazole-5-sulfonamide (PubChem CID 106075528) has the molecular formula C12H24N6O2S and a molecular weight of 316.43 g/mol. Its IUPAC name is N-(4-methylpiperazin-1-yl)-4-(propylaminomethyl)-1H-pyrazole-5-sulfonamide.
| Compound Name | N-(4-methylpiperazin-1-yl)-4-(propylaminomethyl)-1H-pyrazole-5-sulfonamide |
|---|---|
| PubChem CID | 106075528 |
| Molecular Formula | C12H24N6O2S |
| Molecular Weight | 316.43 g/mol |
| Exact Mass | 316.17 |
| IUPAC Name | N-(4-methylpiperazin-1-yl)-4-(propylaminomethyl)-1H-pyrazole-5-sulfonamide |
| SMILES | CCCNCc1cn[nH]c1S(=O)(=O)NN1CCN(C)CC1 |
| InChI | InChI=1S/C12H24N6O2S/c1-3-4-13-9-11-10-14-15-12(11)21(19,20)16-18-7-5-17(2)6-8-18/h10,13,16H,3-9H2,1-2H3,(H,14,15) |
| InChIKey | WXUBTAQUEQKGHH-UHFFFAOYSA-N |
| XLogP | -0.65 |
| TPSA | 93.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.43 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|