C13H26N4O3S — CID 106017591
N-(2-butoxyethyl)-4-(propylaminomethyl)-1H-pyrazole-5-sulfonamide (PubChem CID 106017591) has the molecular formula C13H26N4O3S and a molecular weight of 318.44 g/mol. Its IUPAC name is N-(2-butoxyethyl)-4-(propylaminomethyl)-1H-pyrazole-5-sulfonamide.
| Compound Name | N-(2-butoxyethyl)-4-(propylaminomethyl)-1H-pyrazole-5-sulfonamide |
|---|---|
| PubChem CID | 106017591 |
| Molecular Formula | C13H26N4O3S |
| Molecular Weight | 318.44 g/mol |
| Exact Mass | 318.17 |
| IUPAC Name | N-(2-butoxyethyl)-4-(propylaminomethyl)-1H-pyrazole-5-sulfonamide |
| SMILES | CCCCOCCNS(=O)(=O)c1[nH]ncc1CNCCC |
| InChI | InChI=1S/C13H26N4O3S/c1-3-5-8-20-9-7-16-21(18,19)13-12(11-15-17-13)10-14-6-4-2/h11,14,16H,3-10H2,1-2H3,(H,15,17) |
| InChIKey | VEXSSWVDOCZFKV-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 96.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.44 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|