C11H22N4O3S — CID 106077632
4-(ethylaminomethyl)-N-(2-propan-2-yloxyethyl)-1H-pyrazole-5-sulfonamide (PubChem CID 106077632) has the molecular formula C11H22N4O3S and a molecular weight of 290.39 g/mol. Its IUPAC name is 4-(ethylaminomethyl)-N-(2-propan-2-yloxyethyl)-1H-pyrazole-5-sulfonamide.
| Compound Name | 4-(ethylaminomethyl)-N-(2-propan-2-yloxyethyl)-1H-pyrazole-5-sulfonamide |
|---|---|
| PubChem CID | 106077632 |
| Molecular Formula | C11H22N4O3S |
| Molecular Weight | 290.39 g/mol |
| Exact Mass | 290.14 |
| IUPAC Name | 4-(ethylaminomethyl)-N-(2-propan-2-yloxyethyl)-1H-pyrazole-5-sulfonamide |
| SMILES | CCNCc1cn[nH]c1S(=O)(=O)NCCOC(C)C |
| InChI | InChI=1S/C11H22N4O3S/c1-4-12-7-10-8-13-15-11(10)19(16,17)14-5-6-18-9(2)3/h8-9,12,14H,4-7H2,1-3H3,(H,13,15) |
| InChIKey | SOOFUKAHJDUVOZ-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 96.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.39 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|