C11H20F2N4O3S — CID 106091929
N-[2-(2,2-difluoroethoxy)ethyl]-4-[(propan-2-ylamino)methyl]-1H-pyrazole-5-sulfonamide (PubChem CID 106091929) has the molecular formula C11H20F2N4O3S and a molecular weight of 326.37 g/mol. Its IUPAC name is N-[2-(2,2-difluoroethoxy)ethyl]-4-[(propan-2-ylamino)methyl]-1H-pyrazole-5-sulfonamide.
| Compound Name | N-[2-(2,2-difluoroethoxy)ethyl]-4-[(propan-2-ylamino)methyl]-1H-pyrazole-5-sulfonamide |
|---|---|
| PubChem CID | 106091929 |
| Molecular Formula | C11H20F2N4O3S |
| Molecular Weight | 326.37 g/mol |
| Exact Mass | 326.12 |
| IUPAC Name | N-[2-(2,2-difluoroethoxy)ethyl]-4-[(propan-2-ylamino)methyl]-1H-pyrazole-5-sulfonamide |
| SMILES | CC(C)NCc1cn[nH]c1S(=O)(=O)NCCOCC(F)F |
| InChI | InChI=1S/C11H20F2N4O3S/c1-8(2)14-5-9-6-15-17-11(9)21(18,19)16-3-4-20-7-10(12)13/h6,8,10,14,16H,3-5,7H2,1-2H3,(H,15,17) |
| InChIKey | FHRVMSXPOUEQHS-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 96.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.37 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|