C8H16N4O3S — CID 106019742
4-(aminomethyl)-N-(2-ethoxyethyl)-1H-pyrazole-5-sulfonamide (PubChem CID 106019742) has the molecular formula C8H16N4O3S and a molecular weight of 248.31 g/mol. Its IUPAC name is 4-(aminomethyl)-N-(2-ethoxyethyl)-1H-pyrazole-5-sulfonamide.
| Compound Name | 4-(aminomethyl)-N-(2-ethoxyethyl)-1H-pyrazole-5-sulfonamide |
|---|---|
| PubChem CID | 106019742 |
| Molecular Formula | C8H16N4O3S |
| Molecular Weight | 248.31 g/mol |
| Exact Mass | 248.09 |
| IUPAC Name | 4-(aminomethyl)-N-(2-ethoxyethyl)-1H-pyrazole-5-sulfonamide |
| SMILES | CCOCCNS(=O)(=O)c1[nH]ncc1CN |
| InChI | InChI=1S/C8H16N4O3S/c1-2-15-4-3-11-16(13,14)8-7(5-9)6-10-12-8/h6,11H,2-5,9H2,1H3,(H,10,12) |
| InChIKey | PXFWUCHSCUPIMU-UHFFFAOYSA-N |
| XLogP | -0.82 |
| TPSA | 110.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.31 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|