C12H24N4O3S — CID 106092808
4-(ethylaminomethyl)-N-(5-methoxypentyl)-1H-pyrazole-5-sulfonamide (PubChem CID 106092808) has the molecular formula C12H24N4O3S and a molecular weight of 304.42 g/mol. Its IUPAC name is 4-(ethylaminomethyl)-N-(5-methoxypentyl)-1H-pyrazole-5-sulfonamide.
| Compound Name | 4-(ethylaminomethyl)-N-(5-methoxypentyl)-1H-pyrazole-5-sulfonamide |
|---|---|
| PubChem CID | 106092808 |
| Molecular Formula | C12H24N4O3S |
| Molecular Weight | 304.42 g/mol |
| Exact Mass | 304.16 |
| IUPAC Name | 4-(ethylaminomethyl)-N-(5-methoxypentyl)-1H-pyrazole-5-sulfonamide |
| SMILES | CCNCc1cn[nH]c1S(=O)(=O)NCCCCCOC |
| InChI | InChI=1S/C12H24N4O3S/c1-3-13-9-11-10-14-16-12(11)20(17,18)15-7-5-4-6-8-19-2/h10,13,15H,3-9H2,1-2H3,(H,14,16) |
| InChIKey | LBFACWWJBHDPEO-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 96.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.42 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|