C11H16N4O2S3 — CID 106082756
N-(5-methyl-1,3,4-thiadiazol-2-yl)-5-(propylaminomethyl)thiophene-2-sulfonamide (PubChem CID 106082756) has the molecular formula C11H16N4O2S3 and a molecular weight of 332.48 g/mol. Its IUPAC name is N-(5-methyl-1,3,4-thiadiazol-2-yl)-5-(propylaminomethyl)thiophene-2-sulfonamide.
| Compound Name | N-(5-methyl-1,3,4-thiadiazol-2-yl)-5-(propylaminomethyl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 106082756 |
| Molecular Formula | C11H16N4O2S3 |
| Molecular Weight | 332.48 g/mol |
| Exact Mass | 332.04 |
| IUPAC Name | N-(5-methyl-1,3,4-thiadiazol-2-yl)-5-(propylaminomethyl)thiophene-2-sulfonamide |
| SMILES | CCCNCc1ccc(S(=O)(=O)Nc2nnc(C)s2)s1 |
| InChI | InChI=1S/C11H16N4O2S3/c1-3-6-12-7-9-4-5-10(19-9)20(16,17)15-11-14-13-8(2)18-11/h4-5,12H,3,6-7H2,1-2H3,(H,14,15) |
| InChIKey | JATURUVLUMPNGE-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.48 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|