C11H15BrN4O3S2 — CID 106082750
2-bromo-N-(5-methyl-1,3,4-thiadiazol-2-yl)-5-(propylaminomethyl)furan-3-sulfonamide (PubChem CID 106082750) has the molecular formula C11H15BrN4O3S2 and a molecular weight of 395.30 g/mol. Its IUPAC name is 2-bromo-N-(5-methyl-1,3,4-thiadiazol-2-yl)-5-(propylaminomethyl)furan-3-sulfonamide.
| Compound Name | 2-bromo-N-(5-methyl-1,3,4-thiadiazol-2-yl)-5-(propylaminomethyl)furan-3-sulfonamide |
|---|---|
| PubChem CID | 106082750 |
| Molecular Formula | C11H15BrN4O3S2 |
| Molecular Weight | 395.30 g/mol |
| Exact Mass | 393.98 |
| IUPAC Name | 2-bromo-N-(5-methyl-1,3,4-thiadiazol-2-yl)-5-(propylaminomethyl)furan-3-sulfonamide |
| SMILES | CCCNCc1cc(S(=O)(=O)Nc2nnc(C)s2)c(Br)o1 |
| InChI | InChI=1S/C11H15BrN4O3S2/c1-3-4-13-6-8-5-9(10(12)19-8)21(17,18)16-11-15-14-7(2)20-11/h5,13H,3-4,6H2,1-2H3,(H,15,16) |
| InChIKey | YJPKZUGCFXEHJB-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 97.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.30 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|