C13H19N3O3S2 — CID 106061132
2-methyl-N-(5-methyl-1,3-thiazol-2-yl)-5-(propylaminomethyl)furan-3-sulfonamide (PubChem CID 106061132) has the molecular formula C13H19N3O3S2 and a molecular weight of 329.45 g/mol. Its IUPAC name is 2-methyl-N-(5-methyl-1,3-thiazol-2-yl)-5-(propylaminomethyl)furan-3-sulfonamide.
| Compound Name | 2-methyl-N-(5-methyl-1,3-thiazol-2-yl)-5-(propylaminomethyl)furan-3-sulfonamide |
|---|---|
| PubChem CID | 106061132 |
| Molecular Formula | C13H19N3O3S2 |
| Molecular Weight | 329.45 g/mol |
| Exact Mass | 329.09 |
| IUPAC Name | 2-methyl-N-(5-methyl-1,3-thiazol-2-yl)-5-(propylaminomethyl)furan-3-sulfonamide |
| SMILES | CCCNCc1cc(S(=O)(=O)Nc2ncc(C)s2)c(C)o1 |
| InChI | InChI=1S/C13H19N3O3S2/c1-4-5-14-8-11-6-12(10(3)19-11)21(17,18)16-13-15-7-9(2)20-13/h6-7,14H,4-5,8H2,1-3H3,(H,15,16) |
| InChIKey | GLDVOPNQIAPUCB-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 84.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.45 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|