C12H17N3O2S3 — CID 106060935
N-(5-methyl-1,3-thiazol-2-yl)-2-(propylaminomethyl)thiophene-3-sulfonamide (PubChem CID 106060935) has the molecular formula C12H17N3O2S3 and a molecular weight of 331.49 g/mol. Its IUPAC name is N-(5-methyl-1,3-thiazol-2-yl)-2-(propylaminomethyl)thiophene-3-sulfonamide.
| Compound Name | N-(5-methyl-1,3-thiazol-2-yl)-2-(propylaminomethyl)thiophene-3-sulfonamide |
|---|---|
| PubChem CID | 106060935 |
| Molecular Formula | C12H17N3O2S3 |
| Molecular Weight | 331.49 g/mol |
| Exact Mass | 331.05 |
| IUPAC Name | N-(5-methyl-1,3-thiazol-2-yl)-2-(propylaminomethyl)thiophene-3-sulfonamide |
| SMILES | CCCNCc1sccc1S(=O)(=O)Nc1ncc(C)s1 |
| InChI | InChI=1S/C12H17N3O2S3/c1-3-5-13-8-10-11(4-6-18-10)20(16,17)15-12-14-7-9(2)19-12/h4,6-7,13H,3,5,8H2,1-2H3,(H,14,15) |
| InChIKey | FCJJZFGSGCNWRK-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.49 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|