C13H24N2O2S3 — CID 106080826
N-(2-methyl-2-methylsulfanylpropyl)-2-(propylaminomethyl)thiophene-3-sulfonamide (PubChem CID 106080826) has the molecular formula C13H24N2O2S3 and a molecular weight of 336.55 g/mol. Its IUPAC name is N-(2-methyl-2-methylsulfanylpropyl)-2-(propylaminomethyl)thiophene-3-sulfonamide.
| Compound Name | N-(2-methyl-2-methylsulfanylpropyl)-2-(propylaminomethyl)thiophene-3-sulfonamide |
|---|---|
| PubChem CID | 106080826 |
| Molecular Formula | C13H24N2O2S3 |
| Molecular Weight | 336.55 g/mol |
| Exact Mass | 336.10 |
| IUPAC Name | N-(2-methyl-2-methylsulfanylpropyl)-2-(propylaminomethyl)thiophene-3-sulfonamide |
| SMILES | CCCNCc1sccc1S(=O)(=O)NCC(C)(C)SC |
| InChI | InChI=1S/C13H24N2O2S3/c1-5-7-14-9-11-12(6-8-19-11)20(16,17)15-10-13(2,3)18-4/h6,8,14-15H,5,7,9-10H2,1-4H3 |
| InChIKey | FRHKYDGBCVMPBG-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.55 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|