C15H26N2O2S2 — CID 79361702
2-(propylaminomethyl)-N-(2,2,3,3-tetramethylcyclopropyl)thiophene-3-sulfonamide (PubChem CID 79361702) has the molecular formula C15H26N2O2S2 and a molecular weight of 330.52 g/mol. Its IUPAC name is 2-(propylaminomethyl)-N-(2,2,3,3-tetramethylcyclopropyl)thiophene-3-sulfonamide.
| Compound Name | 2-(propylaminomethyl)-N-(2,2,3,3-tetramethylcyclopropyl)thiophene-3-sulfonamide |
|---|---|
| PubChem CID | 79361702 |
| Molecular Formula | C15H26N2O2S2 |
| Molecular Weight | 330.52 g/mol |
| Exact Mass | 330.14 |
| IUPAC Name | 2-(propylaminomethyl)-N-(2,2,3,3-tetramethylcyclopropyl)thiophene-3-sulfonamide |
| SMILES | CCCNCc1sccc1S(=O)(=O)NC1C(C)(C)C1(C)C |
| InChI | InChI=1S/C15H26N2O2S2/c1-6-8-16-10-11-12(7-9-20-11)21(18,19)17-13-14(2,3)15(13,4)5/h7,9,13,16-17H,6,8,10H2,1-5H3 |
| InChIKey | UURWYCTYXWYBJR-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.52 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|