C12H18N4O2S2 — CID 106061086
N-(5-methyl-1,3-thiazol-2-yl)-5-(propylaminomethyl)-1H-pyrrole-3-sulfonamide (PubChem CID 106061086) has the molecular formula C12H18N4O2S2 and a molecular weight of 314.44 g/mol. Its IUPAC name is N-(5-methyl-1,3-thiazol-2-yl)-5-(propylaminomethyl)-1H-pyrrole-3-sulfonamide.
| Compound Name | N-(5-methyl-1,3-thiazol-2-yl)-5-(propylaminomethyl)-1H-pyrrole-3-sulfonamide |
|---|---|
| PubChem CID | 106061086 |
| Molecular Formula | C12H18N4O2S2 |
| Molecular Weight | 314.44 g/mol |
| Exact Mass | 314.09 |
| IUPAC Name | N-(5-methyl-1,3-thiazol-2-yl)-5-(propylaminomethyl)-1H-pyrrole-3-sulfonamide |
| SMILES | CCCNCc1cc(S(=O)(=O)Nc2ncc(C)s2)c[nH]1 |
| InChI | InChI=1S/C12H18N4O2S2/c1-3-4-13-7-10-5-11(8-14-10)20(17,18)16-12-15-6-9(2)19-12/h5-6,8,13-14H,3-4,7H2,1-2H3,(H,15,16) |
| InChIKey | GIYOXTAIPJAGRM-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.44 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|