C15H27N3O2S — CID 106027622
N-(3-methylcyclohexyl)-5-(propylaminomethyl)-1H-pyrrole-3-sulfonamide (PubChem CID 106027622) has the molecular formula C15H27N3O2S and a molecular weight of 313.47 g/mol. Its IUPAC name is N-(3-methylcyclohexyl)-5-(propylaminomethyl)-1H-pyrrole-3-sulfonamide.
| Compound Name | N-(3-methylcyclohexyl)-5-(propylaminomethyl)-1H-pyrrole-3-sulfonamide |
|---|---|
| PubChem CID | 106027622 |
| Molecular Formula | C15H27N3O2S |
| Molecular Weight | 313.47 g/mol |
| Exact Mass | 313.18 |
| IUPAC Name | N-(3-methylcyclohexyl)-5-(propylaminomethyl)-1H-pyrrole-3-sulfonamide |
| SMILES | CCCNCc1cc(S(=O)(=O)NC2CCCC(C)C2)c[nH]1 |
| InChI | InChI=1S/C15H27N3O2S/c1-3-7-16-10-14-9-15(11-17-14)21(19,20)18-13-6-4-5-12(2)8-13/h9,11-13,16-18H,3-8,10H2,1-2H3 |
| InChIKey | REVILZBYKAPQGW-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 73.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.47 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|