C14H24N4O2S — CID 106073994
N-(1,2,3,5,6,7,8,8a-octahydroindolizin-7-yl)-5-(methylaminomethyl)-1H-pyrrole-3-sulfonamide (PubChem CID 106073994) has the molecular formula C14H24N4O2S and a molecular weight of 312.44 g/mol. Its IUPAC name is N-(1,2,3,5,6,7,8,8a-octahydroindolizin-7-yl)-5-(methylaminomethyl)-1H-pyrrole-3-sulfonamide.
| Compound Name | N-(1,2,3,5,6,7,8,8a-octahydroindolizin-7-yl)-5-(methylaminomethyl)-1H-pyrrole-3-sulfonamide |
|---|---|
| PubChem CID | 106073994 |
| Molecular Formula | C14H24N4O2S |
| Molecular Weight | 312.44 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | N-(1,2,3,5,6,7,8,8a-octahydroindolizin-7-yl)-5-(methylaminomethyl)-1H-pyrrole-3-sulfonamide |
| SMILES | CNCc1cc(S(=O)(=O)NC2CCN3CCCC3C2)c[nH]1 |
| InChI | InChI=1S/C14H24N4O2S/c1-15-9-12-8-14(10-16-12)21(19,20)17-11-4-6-18-5-2-3-13(18)7-11/h8,10-11,13,15-17H,2-7,9H2,1H3 |
| InChIKey | DUUWKZQDAYHICE-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 77.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.44 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |