C12H21N3O2S2 — CID 106086267
5-[(propan-2-ylamino)methyl]-N-(thiolan-3-yl)-1H-pyrrole-3-sulfonamide (PubChem CID 106086267) has the molecular formula C12H21N3O2S2 and a molecular weight of 303.45 g/mol. Its IUPAC name is 5-[(propan-2-ylamino)methyl]-N-(thiolan-3-yl)-1H-pyrrole-3-sulfonamide.
| Compound Name | 5-[(propan-2-ylamino)methyl]-N-(thiolan-3-yl)-1H-pyrrole-3-sulfonamide |
|---|---|
| PubChem CID | 106086267 |
| Molecular Formula | C12H21N3O2S2 |
| Molecular Weight | 303.45 g/mol |
| Exact Mass | 303.11 |
| IUPAC Name | 5-[(propan-2-ylamino)methyl]-N-(thiolan-3-yl)-1H-pyrrole-3-sulfonamide |
| SMILES | CC(C)NCc1cc(S(=O)(=O)NC2CCSC2)c[nH]1 |
| InChI | InChI=1S/C12H21N3O2S2/c1-9(2)13-6-11-5-12(7-14-11)19(16,17)15-10-3-4-18-8-10/h5,7,9-10,13-15H,3-4,6,8H2,1-2H3 |
| InChIKey | UBBZUEAFLPDGKJ-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 73.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.45 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |