C15H27N3O2S — CID 107402936
N-(cyclobutylmethyl)-N-ethyl-5-[(propan-2-ylamino)methyl]-1H-pyrrole-3-sulfonamide (PubChem CID 107402936) has the molecular formula C15H27N3O2S and a molecular weight of 313.47 g/mol. Its IUPAC name is N-(cyclobutylmethyl)-N-ethyl-5-[(propan-2-ylamino)methyl]-1H-pyrrole-3-sulfonamide.
| Compound Name | N-(cyclobutylmethyl)-N-ethyl-5-[(propan-2-ylamino)methyl]-1H-pyrrole-3-sulfonamide |
|---|---|
| PubChem CID | 107402936 |
| Molecular Formula | C15H27N3O2S |
| Molecular Weight | 313.47 g/mol |
| Exact Mass | 313.18 |
| IUPAC Name | N-(cyclobutylmethyl)-N-ethyl-5-[(propan-2-ylamino)methyl]-1H-pyrrole-3-sulfonamide |
| SMILES | CCN(CC1CCC1)S(=O)(=O)c1c[nH]c(CNC(C)C)c1 |
| InChI | InChI=1S/C15H27N3O2S/c1-4-18(11-13-6-5-7-13)21(19,20)15-8-14(17-10-15)9-16-12(2)3/h8,10,12-13,16-17H,4-7,9,11H2,1-3H3 |
| InChIKey | YBEOMWHSVRSGHE-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 65.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.47 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |