C12H20N6O2S — CID 106068070
5-(propylaminomethyl)-N-[2-(1H-1,2,4-triazol-5-yl)ethyl]-1H-pyrrole-3-sulfonamide (PubChem CID 106068070) has the molecular formula C12H20N6O2S and a molecular weight of 312.40 g/mol. Its IUPAC name is 5-(propylaminomethyl)-N-[2-(1H-1,2,4-triazol-5-yl)ethyl]-1H-pyrrole-3-sulfonamide.
| Compound Name | 5-(propylaminomethyl)-N-[2-(1H-1,2,4-triazol-5-yl)ethyl]-1H-pyrrole-3-sulfonamide |
|---|---|
| PubChem CID | 106068070 |
| Molecular Formula | C12H20N6O2S |
| Molecular Weight | 312.40 g/mol |
| Exact Mass | 312.14 |
| IUPAC Name | 5-(propylaminomethyl)-N-[2-(1H-1,2,4-triazol-5-yl)ethyl]-1H-pyrrole-3-sulfonamide |
| SMILES | CCCNCc1cc(S(=O)(=O)NCCc2ncn[nH]2)c[nH]1 |
| InChI | InChI=1S/C12H20N6O2S/c1-2-4-13-7-10-6-11(8-14-10)21(19,20)17-5-3-12-15-9-16-18-12/h6,8-9,13-14,17H,2-5,7H2,1H3,(H,15,16,18) |
| InChIKey | GGRIOVLLLAZDQS-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 115.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.40 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|