C10H13N5O4S — CID 64547602
4-[3-(1H-1,2,4-triazol-5-yl)propylsulfamoyl]-1H-pyrrole-2-carboxylic acid (PubChem CID 64547602) has the molecular formula C10H13N5O4S and a molecular weight of 299.31 g/mol. Its IUPAC name is 4-[3-(1H-1,2,4-triazol-5-yl)propylsulfamoyl]-1H-pyrrole-2-carboxylic acid.
| Compound Name | 4-[3-(1H-1,2,4-triazol-5-yl)propylsulfamoyl]-1H-pyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 64547602 |
| Molecular Formula | C10H13N5O4S |
| Molecular Weight | 299.31 g/mol |
| Exact Mass | 299.07 |
| IUPAC Name | 4-[3-(1H-1,2,4-triazol-5-yl)propylsulfamoyl]-1H-pyrrole-2-carboxylic acid |
| SMILES | O=C(O)c1cc(S(=O)(=O)NCCCc2ncn[nH]2)c[nH]1 |
| InChI | InChI=1S/C10H13N5O4S/c16-10(17)8-4-7(5-11-8)20(18,19)14-3-1-2-9-12-6-13-15-9/h4-6,11,14H,1-3H2,(H,16,17)(H,12,13,15) |
| InChIKey | FNFOFIYSDDCYKT-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 140.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.31 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|