C11H12Br2N4O2S — CID 64531882
2,4-dibromo-N-[3-(1H-1,2,4-triazol-5-yl)propyl]benzenesulfonamide (PubChem CID 64531882) has the molecular formula C11H12Br2N4O2S and a molecular weight of 424.12 g/mol. Its IUPAC name is 2,4-dibromo-N-[3-(1H-1,2,4-triazol-5-yl)propyl]benzenesulfonamide.
| Compound Name | 2,4-dibromo-N-[3-(1H-1,2,4-triazol-5-yl)propyl]benzenesulfonamide |
|---|---|
| PubChem CID | 64531882 |
| Molecular Formula | C11H12Br2N4O2S |
| Molecular Weight | 424.12 g/mol |
| Exact Mass | 421.90 |
| IUPAC Name | 2,4-dibromo-N-[3-(1H-1,2,4-triazol-5-yl)propyl]benzenesulfonamide |
| SMILES | O=S(=O)(NCCCc1ncn[nH]1)c1ccc(Br)cc1Br |
| InChI | InChI=1S/C11H12Br2N4O2S/c12-8-3-4-10(9(13)6-8)20(18,19)16-5-1-2-11-14-7-15-17-11/h3-4,6-7,16H,1-2,5H2,(H,14,15,17) |
| InChIKey | DEGIRWOFBFXKOG-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.12 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|