C8H12N2O4S2 — CID 43525958
4-(2-methylsulfanylethylsulfamoyl)-1H-pyrrole-2-carboxylic acid (PubChem CID 43525958) has the molecular formula C8H12N2O4S2 and a molecular weight of 264.33 g/mol. Its IUPAC name is 4-(2-methylsulfanylethylsulfamoyl)-1H-pyrrole-2-carboxylic acid.
| Compound Name | 4-(2-methylsulfanylethylsulfamoyl)-1H-pyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 43525958 |
| Molecular Formula | C8H12N2O4S2 |
| Molecular Weight | 264.33 g/mol |
| Exact Mass | 264.02 |
| IUPAC Name | 4-(2-methylsulfanylethylsulfamoyl)-1H-pyrrole-2-carboxylic acid |
| SMILES | CSCCNS(=O)(=O)c1c[nH]c(C(=O)O)c1 |
| InChI | InChI=1S/C8H12N2O4S2/c1-15-3-2-10-16(13,14)6-4-7(8(11)12)9-5-6/h4-5,9-10H,2-3H2,1H3,(H,11,12) |
| InChIKey | GOBOEYVUGLYOME-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 99.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.33 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|