C9H14N2O5S — CID 65034109
4-[(3-hydroxy-2-methylpropyl)sulfamoyl]-1H-pyrrole-2-carboxylic acid (PubChem CID 65034109) has the molecular formula C9H14N2O5S and a molecular weight of 262.29 g/mol. Its IUPAC name is 4-[(3-hydroxy-2-methylpropyl)sulfamoyl]-1H-pyrrole-2-carboxylic acid.
| Compound Name | 4-[(3-hydroxy-2-methylpropyl)sulfamoyl]-1H-pyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 65034109 |
| Molecular Formula | C9H14N2O5S |
| Molecular Weight | 262.29 g/mol |
| Exact Mass | 262.06 |
| IUPAC Name | 4-[(3-hydroxy-2-methylpropyl)sulfamoyl]-1H-pyrrole-2-carboxylic acid |
| SMILES | CC(CO)CNS(=O)(=O)c1c[nH]c(C(=O)O)c1 |
| InChI | InChI=1S/C9H14N2O5S/c1-6(5-12)3-11-17(15,16)7-2-8(9(13)14)10-4-7/h2,4,6,10-12H,3,5H2,1H3,(H,13,14) |
| InChIKey | YYXAFRHBMIOIQN-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 119.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.29 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |