C10H16N2O4S — CID 61167038
4-(2,2-dimethylpropylsulfamoyl)-1H-pyrrole-2-carboxylic acid (PubChem CID 61167038) has the molecular formula C10H16N2O4S and a molecular weight of 260.31 g/mol. Its IUPAC name is 4-(2,2-dimethylpropylsulfamoyl)-1H-pyrrole-2-carboxylic acid.
| Compound Name | 4-(2,2-dimethylpropylsulfamoyl)-1H-pyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 61167038 |
| Molecular Formula | C10H16N2O4S |
| Molecular Weight | 260.31 g/mol |
| Exact Mass | 260.08 |
| IUPAC Name | 4-(2,2-dimethylpropylsulfamoyl)-1H-pyrrole-2-carboxylic acid |
| SMILES | CC(C)(C)CNS(=O)(=O)c1c[nH]c(C(=O)O)c1 |
| InChI | InChI=1S/C10H16N2O4S/c1-10(2,3)6-12-17(15,16)7-4-8(9(13)14)11-5-7/h4-5,11-12H,6H2,1-3H3,(H,13,14) |
| InChIKey | DEYGBTQQDOUDJV-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 99.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.31 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |