C19H26N2O4S2 — CID 86896965
N-[[5-[2-[4-(2-methylpropoxy)phenyl]ethylsulfamoyl]thiophen-2-yl]methyl]acetamide (PubChem CID 86896965) has the molecular formula C19H26N2O4S2 and a molecular weight of 410.56 g/mol. Its IUPAC name is N-[[5-[2-[4-(2-methylpropoxy)phenyl]ethylsulfamoyl]thiophen-2-yl]methyl]acetamide.
| Compound Name | N-[[5-[2-[4-(2-methylpropoxy)phenyl]ethylsulfamoyl]thiophen-2-yl]methyl]acetamide |
|---|---|
| PubChem CID | 86896965 |
| Molecular Formula | C19H26N2O4S2 |
| Molecular Weight | 410.56 g/mol |
| Exact Mass | 410.13 |
| IUPAC Name | N-[[5-[2-[4-(2-methylpropoxy)phenyl]ethylsulfamoyl]thiophen-2-yl]methyl]acetamide |
| SMILES | CC(=O)NCc1ccc(S(=O)(=O)NCCc2ccc(OCC(C)C)cc2)s1 |
| InChI | InChI=1S/C19H26N2O4S2/c1-14(2)13-25-17-6-4-16(5-7-17)10-11-21-27(23,24)19-9-8-18(26-19)12-20-15(3)22/h4-9,14,21H,10-13H2,1-3H3,(H,20,22) |
| InChIKey | MVZMHNGYMRBNDP-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.56 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |