C17H22N2O3S2 — CID 16553889
N-[[5-[(4-butan-2-ylphenyl)sulfamoyl]thiophen-2-yl]methyl]acetamide (PubChem CID 16553889) has the molecular formula C17H22N2O3S2 and a molecular weight of 366.51 g/mol. Its IUPAC name is N-[[5-[(4-butan-2-ylphenyl)sulfamoyl]thiophen-2-yl]methyl]acetamide.
| Compound Name | N-[[5-[(4-butan-2-ylphenyl)sulfamoyl]thiophen-2-yl]methyl]acetamide |
|---|---|
| PubChem CID | 16553889 |
| Molecular Formula | C17H22N2O3S2 |
| Molecular Weight | 366.51 g/mol |
| Exact Mass | 366.11 |
| IUPAC Name | N-[[5-[(4-butan-2-ylphenyl)sulfamoyl]thiophen-2-yl]methyl]acetamide |
| SMILES | CCC(C)c1ccc(NS(=O)(=O)c2ccc(CNC(C)=O)s2)cc1 |
| InChI | InChI=1S/C17H22N2O3S2/c1-4-12(2)14-5-7-15(8-6-14)19-24(21,22)17-10-9-16(23-17)11-18-13(3)20/h5-10,12,19H,4,11H2,1-3H3,(H,18,20) |
| InChIKey | OPCYVGKVHRSVTQ-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.51 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |