C15H16ClN3O4S2 — CID 16604918
N-[[5-[(4-acetamido-3-chlorophenyl)sulfamoyl]thiophen-2-yl]methyl]acetamide (PubChem CID 16604918) has the molecular formula C15H16ClN3O4S2 and a molecular weight of 401.90 g/mol. Its IUPAC name is N-[[5-[(4-acetamido-3-chlorophenyl)sulfamoyl]thiophen-2-yl]methyl]acetamide.
| Compound Name | N-[[5-[(4-acetamido-3-chlorophenyl)sulfamoyl]thiophen-2-yl]methyl]acetamide |
|---|---|
| PubChem CID | 16604918 |
| Molecular Formula | C15H16ClN3O4S2 |
| Molecular Weight | 401.90 g/mol |
| Exact Mass | 401.03 |
| IUPAC Name | N-[[5-[(4-acetamido-3-chlorophenyl)sulfamoyl]thiophen-2-yl]methyl]acetamide |
| SMILES | CC(=O)NCc1ccc(S(=O)(=O)Nc2ccc(NC(C)=O)c(Cl)c2)s1 |
| InChI | InChI=1S/C15H16ClN3O4S2/c1-9(20)17-8-12-4-6-15(24-12)25(22,23)19-11-3-5-14(13(16)7-11)18-10(2)21/h3-7,19H,8H2,1-2H3,(H,17,20)(H,18,21) |
| InChIKey | JWTLGEZYNPDWNI-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.90 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |