C18H23N3O6S3 — CID 16553878
N-[[5-[(4-methyl-3-morpholin-4-ylsulfonylphenyl)sulfamoyl]thiophen-2-yl]methyl]acetamide (PubChem CID 16553878) has the molecular formula C18H23N3O6S3 and a molecular weight of 473.60 g/mol. Its IUPAC name is N-[[5-[(4-methyl-3-morpholin-4-ylsulfonylphenyl)sulfamoyl]thiophen-2-yl]methyl]acetamide.
| Compound Name | N-[[5-[(4-methyl-3-morpholin-4-ylsulfonylphenyl)sulfamoyl]thiophen-2-yl]methyl]acetamide |
|---|---|
| PubChem CID | 16553878 |
| Molecular Formula | C18H23N3O6S3 |
| Molecular Weight | 473.60 g/mol |
| Exact Mass | 473.07 |
| IUPAC Name | N-[[5-[(4-methyl-3-morpholin-4-ylsulfonylphenyl)sulfamoyl]thiophen-2-yl]methyl]acetamide |
| SMILES | CC(=O)NCc1ccc(S(=O)(=O)Nc2ccc(C)c(S(=O)(=O)N3CCOCC3)c2)s1 |
| InChI | InChI=1S/C18H23N3O6S3/c1-13-3-4-15(11-17(13)30(25,26)21-7-9-27-10-8-21)20-29(23,24)18-6-5-16(28-18)12-19-14(2)22/h3-6,11,20H,7-10,12H2,1-2H3,(H,19,22) |
| InChIKey | KRBFXURVBGICIC-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.60 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |