C18H20BrN3O6S — CID 24620415
5-bromo-N-[2-(4-methyl-3-morpholin-4-ylsulfonylanilino)-2-oxoethyl]furan-2-carboxamide (PubChem CID 24620415) has the molecular formula C18H20BrN3O6S and a molecular weight of 486.34 g/mol. Its IUPAC name is 5-bromo-N-[2-(4-methyl-3-morpholin-4-ylsulfonylanilino)-2-oxoethyl]furan-2-carboxamide.
| Compound Name | 5-bromo-N-[2-(4-methyl-3-morpholin-4-ylsulfonylanilino)-2-oxoethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 24620415 |
| Molecular Formula | C18H20BrN3O6S |
| Molecular Weight | 486.34 g/mol |
| Exact Mass | 485.03 |
| IUPAC Name | 5-bromo-N-[2-(4-methyl-3-morpholin-4-ylsulfonylanilino)-2-oxoethyl]furan-2-carboxamide |
| SMILES | Cc1ccc(NC(=O)CNC(=O)c2ccc(Br)o2)cc1S(=O)(=O)N1CCOCC1 |
| InChI | InChI=1S/C18H20BrN3O6S/c1-12-2-3-13(10-15(12)29(25,26)22-6-8-27-9-7-22)21-17(23)11-20-18(24)14-4-5-16(19)28-14/h2-5,10H,6-9,11H2,1H3,(H,20,24)(H,21,23) |
| InChIKey | VFFFURIGFQRSRZ-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 117.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.34 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |