C21H23N3O6S2 — CID 46489210
2-[(4-cyanophenyl)methylsulfonyl]-N-(4-methyl-3-morpholin-4-ylsulfonylphenyl)acetamide (PubChem CID 46489210) has the molecular formula C21H23N3O6S2 and a molecular weight of 477.56 g/mol. Its IUPAC name is 2-[(4-cyanophenyl)methylsulfonyl]-N-(4-methyl-3-morpholin-4-ylsulfonylphenyl)acetamide.
| Compound Name | 2-[(4-cyanophenyl)methylsulfonyl]-N-(4-methyl-3-morpholin-4-ylsulfonylphenyl)acetamide |
|---|---|
| PubChem CID | 46489210 |
| Molecular Formula | C21H23N3O6S2 |
| Molecular Weight | 477.56 g/mol |
| Exact Mass | 477.10 |
| IUPAC Name | 2-[(4-cyanophenyl)methylsulfonyl]-N-(4-methyl-3-morpholin-4-ylsulfonylphenyl)acetamide |
| SMILES | Cc1ccc(NC(=O)CS(=O)(=O)Cc2ccc(C#N)cc2)cc1S(=O)(=O)N1CCOCC1 |
| InChI | InChI=1S/C21H23N3O6S2/c1-16-2-7-19(12-20(16)32(28,29)24-8-10-30-11-9-24)23-21(25)15-31(26,27)14-18-5-3-17(13-22)4-6-18/h2-7,12H,8-11,14-15H2,1H3,(H,23,25) |
| InChIKey | HGMMNKIFHSUIOW-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 133.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.56 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |