C15H18N2O5S2 — CID 16553867
N-[[5-[(3,4-dimethoxyphenyl)sulfamoyl]thiophen-2-yl]methyl]acetamide (PubChem CID 16553867) has the molecular formula C15H18N2O5S2 and a molecular weight of 370.45 g/mol. Its IUPAC name is N-[[5-[(3,4-dimethoxyphenyl)sulfamoyl]thiophen-2-yl]methyl]acetamide.
| Compound Name | N-[[5-[(3,4-dimethoxyphenyl)sulfamoyl]thiophen-2-yl]methyl]acetamide |
|---|---|
| PubChem CID | 16553867 |
| Molecular Formula | C15H18N2O5S2 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.07 |
| IUPAC Name | N-[[5-[(3,4-dimethoxyphenyl)sulfamoyl]thiophen-2-yl]methyl]acetamide |
| SMILES | COc1ccc(NS(=O)(=O)c2ccc(CNC(C)=O)s2)cc1OC |
| InChI | InChI=1S/C15H18N2O5S2/c1-10(18)16-9-12-5-7-15(23-12)24(19,20)17-11-4-6-13(21-2)14(8-11)22-3/h4-8,17H,9H2,1-3H3,(H,16,18) |
| InChIKey | VUULRUXSZWINIA-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |