C20H18N2O6S2 — CID 71612287
methyl 4-[[5-(benzamidomethyl)thiophen-2-yl]sulfonylamino]-2-hydroxybenzoate (PubChem CID 71612287) has the molecular formula C20H18N2O6S2 and a molecular weight of 446.51 g/mol. Its IUPAC name is methyl 4-[[5-(benzamidomethyl)thiophen-2-yl]sulfonylamino]-2-hydroxybenzoate.
| Compound Name | methyl 4-[[5-(benzamidomethyl)thiophen-2-yl]sulfonylamino]-2-hydroxybenzoate |
|---|---|
| PubChem CID | 71612287 |
| Molecular Formula | C20H18N2O6S2 |
| Molecular Weight | 446.51 g/mol |
| Exact Mass | 446.06 |
| IUPAC Name | methyl 4-[[5-(benzamidomethyl)thiophen-2-yl]sulfonylamino]-2-hydroxybenzoate |
| SMILES | COC(=O)c1ccc(NS(=O)(=O)c2ccc(CNC(=O)c3ccccc3)s2)cc1O |
| InChI | InChI=1S/C20H18N2O6S2/c1-28-20(25)16-9-7-14(11-17(16)23)22-30(26,27)18-10-8-15(29-18)12-21-19(24)13-5-3-2-4-6-13/h2-11,22-23H,12H2,1H3,(H,21,24) |
| InChIKey | FCIMOPZNLMCVPO-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 121.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.51 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |