C8H14N2O3S2 — CID 43155671
5-(aminomethyl)-N-(2-methoxyethyl)thiophene-2-sulfonamide (PubChem CID 43155671) has the molecular formula C8H14N2O3S2 and a molecular weight of 250.34 g/mol. Its IUPAC name is 5-(aminomethyl)-N-(2-methoxyethyl)thiophene-2-sulfonamide.
| Compound Name | 5-(aminomethyl)-N-(2-methoxyethyl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 43155671 |
| Molecular Formula | C8H14N2O3S2 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.04 |
| IUPAC Name | 5-(aminomethyl)-N-(2-methoxyethyl)thiophene-2-sulfonamide |
| SMILES | COCCNS(=O)(=O)c1ccc(CN)s1 |
| InChI | InChI=1S/C8H14N2O3S2/c1-13-5-4-10-15(11,12)8-3-2-7(6-9)14-8/h2-3,10H,4-6,9H2,1H3 |
| InChIKey | YBVWJXWFLCXKAW-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|