C9H17N3O2S2 — CID 43155677
5-(aminomethyl)-N-[2-(dimethylamino)ethyl]thiophene-2-sulfonamide (PubChem CID 43155677) has the molecular formula C9H17N3O2S2 and a molecular weight of 263.39 g/mol. Its IUPAC name is 5-(aminomethyl)-N-[2-(dimethylamino)ethyl]thiophene-2-sulfonamide.
| Compound Name | 5-(aminomethyl)-N-[2-(dimethylamino)ethyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 43155677 |
| Molecular Formula | C9H17N3O2S2 |
| Molecular Weight | 263.39 g/mol |
| Exact Mass | 263.08 |
| IUPAC Name | 5-(aminomethyl)-N-[2-(dimethylamino)ethyl]thiophene-2-sulfonamide |
| SMILES | CN(C)CCNS(=O)(=O)c1ccc(CN)s1 |
| InChI | InChI=1S/C9H17N3O2S2/c1-12(2)6-5-11-16(13,14)9-4-3-8(7-10)15-9/h3-4,11H,5-7,10H2,1-2H3 |
| InChIKey | ZDMKBZZVABCQEO-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.39 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |