C9H16BrN3O2S2 — CID 114138920
5-(aminomethyl)-2-bromo-N-[2-(dimethylamino)ethyl]thiophene-3-sulfonamide (PubChem CID 114138920) has the molecular formula C9H16BrN3O2S2 and a molecular weight of 342.28 g/mol. Its IUPAC name is 5-(aminomethyl)-2-bromo-N-[2-(dimethylamino)ethyl]thiophene-3-sulfonamide.
| Compound Name | 5-(aminomethyl)-2-bromo-N-[2-(dimethylamino)ethyl]thiophene-3-sulfonamide |
|---|---|
| PubChem CID | 114138920 |
| Molecular Formula | C9H16BrN3O2S2 |
| Molecular Weight | 342.28 g/mol |
| Exact Mass | 340.99 |
| IUPAC Name | 5-(aminomethyl)-2-bromo-N-[2-(dimethylamino)ethyl]thiophene-3-sulfonamide |
| SMILES | CN(C)CCNS(=O)(=O)c1cc(CN)sc1Br |
| InChI | InChI=1S/C9H16BrN3O2S2/c1-13(2)4-3-12-17(14,15)8-5-7(6-11)16-9(8)10/h5,12H,3-4,6,11H2,1-2H3 |
| InChIKey | GHFMIMZHERRPRX-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.28 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |