C10H14BrN5O2S2 — CID 106077061
5-(aminomethyl)-2-bromo-N-[3-(triazol-1-yl)propyl]thiophene-3-sulfonamide (PubChem CID 106077061) has the molecular formula C10H14BrN5O2S2 and a molecular weight of 380.29 g/mol. Its IUPAC name is 5-(aminomethyl)-2-bromo-N-[3-(triazol-1-yl)propyl]thiophene-3-sulfonamide.
| Compound Name | 5-(aminomethyl)-2-bromo-N-[3-(triazol-1-yl)propyl]thiophene-3-sulfonamide |
|---|---|
| PubChem CID | 106077061 |
| Molecular Formula | C10H14BrN5O2S2 |
| Molecular Weight | 380.29 g/mol |
| Exact Mass | 378.98 |
| IUPAC Name | 5-(aminomethyl)-2-bromo-N-[3-(triazol-1-yl)propyl]thiophene-3-sulfonamide |
| SMILES | NCc1cc(S(=O)(=O)NCCCn2ccnn2)c(Br)s1 |
| InChI | InChI=1S/C10H14BrN5O2S2/c11-10-9(6-8(7-12)19-10)20(17,18)14-2-1-4-16-5-3-13-15-16/h3,5-6,14H,1-2,4,7,12H2 |
| InChIKey | VNKMIFJEAALNQM-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 102.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.29 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|