C11H17N5O2S2 — CID 106077042
5-(aminomethyl)-2-methyl-N-[3-(triazol-1-yl)propyl]thiophene-3-sulfonamide (PubChem CID 106077042) has the molecular formula C11H17N5O2S2 and a molecular weight of 315.42 g/mol. Its IUPAC name is 5-(aminomethyl)-2-methyl-N-[3-(triazol-1-yl)propyl]thiophene-3-sulfonamide.
| Compound Name | 5-(aminomethyl)-2-methyl-N-[3-(triazol-1-yl)propyl]thiophene-3-sulfonamide |
|---|---|
| PubChem CID | 106077042 |
| Molecular Formula | C11H17N5O2S2 |
| Molecular Weight | 315.42 g/mol |
| Exact Mass | 315.08 |
| IUPAC Name | 5-(aminomethyl)-2-methyl-N-[3-(triazol-1-yl)propyl]thiophene-3-sulfonamide |
| SMILES | Cc1sc(CN)cc1S(=O)(=O)NCCCn1ccnn1 |
| InChI | InChI=1S/C11H17N5O2S2/c1-9-11(7-10(8-12)19-9)20(17,18)14-3-2-5-16-6-4-13-15-16/h4,6-7,14H,2-3,5,8,12H2,1H3 |
| InChIKey | GETCTRVZBDNFOT-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 102.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.42 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|